C16H11FO4 — CID 28943189
3-[(4-fluorophenoxy)methyl]-1-benzofuran-2-carboxylic acid (PubChem CID 28943189) has the molecular formula C16H11FO4 and a molecular weight of 286.26 g/mol. Its IUPAC name is 3-[(4-fluorophenoxy)methyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-[(4-fluorophenoxy)methyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 28943189 |
| Molecular Formula | C16H11FO4 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-[(4-fluorophenoxy)methyl]-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)c1oc2ccccc2c1COc1ccc(F)cc1 |
| InChI | InChI=1S/C16H11FO4/c17-10-5-7-11(8-6-10)20-9-13-12-3-1-2-4-14(12)21-15(13)16(18)19/h1-8H,9H2,(H,18,19) |
| InChIKey | OBDDFPNRZLTAHU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |