C24H21N3O5 — CID 30423465
[2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 30423465) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 30423465 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [2-[bis(2-cyanoethyl)amino]-2-oxoethyl] 3-(phenoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | N#CCCN(CCC#N)C(=O)COC(=O)c1oc2ccccc2c1COc1ccccc1 |
| InChI | InChI=1S/C24H21N3O5/c25-12-6-14-27(15-7-13-26)22(28)17-31-24(29)23-20(16-30-18-8-2-1-3-9-18)19-10-4-5-11-21(19)32-23/h1-5,8-11H,6-7,14-17H2 |
| InChIKey | SSLZFALFGANGKI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 116.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |