C16H19N3O3 — CID 51095519
N,N-bis(2-cyanoethyl)-2-(2-phenoxyethoxy)acetamide (PubChem CID 51095519) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-(2-phenoxyethoxy)acetamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-(2-phenoxyethoxy)acetamide |
|---|---|
| PubChem CID | 51095519 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-(2-phenoxyethoxy)acetamide |
| SMILES | N#CCCN(CCC#N)C(=O)COCCOc1ccccc1 |
| InChI | InChI=1S/C16H19N3O3/c17-8-4-10-19(11-5-9-18)16(20)14-21-12-13-22-15-6-2-1-3-7-15/h1-3,6-7H,4-5,10-14H2 |
| InChIKey | VMTMCYFNHJBJDC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|