C20H20N4O2 — CID 78822833
N,N-bis(2-cyanoethyl)-2-(2-phenoxyanilino)acetamide (PubChem CID 78822833) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-(2-phenoxyanilino)acetamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-(2-phenoxyanilino)acetamide |
|---|---|
| PubChem CID | 78822833 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-(2-phenoxyanilino)acetamide |
| SMILES | N#CCCN(CCC#N)C(=O)CNc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C20H20N4O2/c21-12-6-14-24(15-7-13-22)20(25)16-23-18-10-4-5-11-19(18)26-17-8-2-1-3-9-17/h1-5,8-11,23H,6-7,14-16H2 |
| InChIKey | HHCOYVWMPKWKLV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |