About [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate (PubChem CID 2435467) has the molecular formula C24H20N2O4
and a molecular weight of 400.43 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate.
Molecular Properties
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate |
| PubChem CID | 2435467 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate |
| SMILES | N#CCCN(C(=O)COC(=O)c1ccccc1Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O4/c25-16-9-17-26(19-10-3-1-4-11-19)23(27)18-29-24(28)21-14-7-8-15-22(21)30-20-12-5-2-6-13-20/h1-8,10-15H,9,17-18H2 |
| InChIKey | BPDFOSSMXLCNTE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate?
The IUPAC name of [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate (CID 2435467) is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate.
What is the SMILES notation for [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate?
The canonical SMILES for [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate is N#CCCN(C(=O)COC(=O)c1ccccc1Oc1ccccc1)c1ccccc1.
What is the InChIKey of [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate?
The InChIKey is BPDFOSSMXLCNTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O4/c25-16-9-17-26(19-10-3-1-4-11-19)23(27)18-29-24(28)21-14-7-8-15-22(21)30-20-12-5-2-6-13-20/h1-8,10-15H,9,17-18H2.
What are the key properties of [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate?
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate has a molecular weight of 400.43 g/mol, XLogP of 4.58, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-phenoxybenzoate is sourced from PubChem (CID 2435467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).