C19H16N2O4 — CID 2504514
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-formylbenzoate (PubChem CID 2504514) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 2504514 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-formylbenzoate |
| SMILES | N#CCCN(C(=O)COC(=O)c1ccc(C=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O4/c20-11-4-12-21(17-5-2-1-3-6-17)18(23)14-25-19(24)16-9-7-15(13-22)8-10-16/h1-3,5-10,13H,4,12,14H2 |
| InChIKey | QWFMBPZHYXLLJL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|