C18H16N2O4 — CID 7790207
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-hydroxybenzoate (PubChem CID 7790207) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-hydroxybenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 7790207 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-hydroxybenzoate |
| SMILES | N#CCCN(C(=O)COC(=O)c1cccc(O)c1)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O4/c19-10-5-11-20(15-7-2-1-3-8-15)17(22)13-24-18(23)14-6-4-9-16(21)12-14/h1-4,6-9,12,21H,5,11,13H2 |
| InChIKey | QXOOHKWCCOLQGV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |