C20H20N2O5S — CID 7753170
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate (PubChem CID 7753170) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 7753170 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-(methylsulfonylmethyl)benzoate |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)OCC(=O)N(CCC#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N2O5S/c1-28(25,26)15-16-8-10-17(11-9-16)20(24)27-14-19(23)22(13-5-12-21)18-6-3-2-4-7-18/h2-4,6-11H,5,13-15H2,1H3 |
| InChIKey | IFIGBETXSVVEPD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |