C22H19N3O5S2 — CID 4618784
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 4618784) has the molecular formula C22H19N3O5S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 4618784 |
| Molecular Formula | C22H19N3O5S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 4-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | N#CCCN(C(=O)COC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O5S2/c23-13-5-14-25(19-6-2-1-3-7-19)20(26)16-30-22(27)17-9-11-18(12-10-17)24-32(28,29)21-8-4-15-31-21/h1-4,6-12,15,24H,5,14,16H2 |
| InChIKey | XAZSTGXYKPKHIY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |