C20H18FN3O4 — CID 2640604
[2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 4-acetamidobenzoate (PubChem CID 2640604) has the molecular formula C20H18FN3O4 and a molecular weight of 383.38 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 4-acetamidobenzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 2640604 |
| Molecular Formula | C20H18FN3O4 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCC(=O)N(CCC#N)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H18FN3O4/c1-14(25)23-17-7-3-15(4-8-17)20(27)28-13-19(26)24(12-2-11-22)18-9-5-16(21)6-10-18/h3-10H,2,12-13H2,1H3,(H,23,25) |
| InChIKey | IOAGHGGWMBFRGE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |