C19H18FN3O5S — CID 16519130
[2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 2-(methanesulfonamido)benzoate (PubChem CID 16519130) has the molecular formula C19H18FN3O5S and a molecular weight of 419.43 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 2-(methanesulfonamido)benzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 16519130 |
| Molecular Formula | C19H18FN3O5S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 2-(methanesulfonamido)benzoate |
| SMILES | CS(=O)(=O)Nc1ccccc1C(=O)OCC(=O)N(CCC#N)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FN3O5S/c1-29(26,27)22-17-6-3-2-5-16(17)19(25)28-13-18(24)23(12-4-11-21)15-9-7-14(20)8-10-15/h2-3,5-10,22H,4,12-13H2,1H3 |
| InChIKey | SRSHKYVJMNVYSZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |