C26H23FN2O4 — CID 16514857
[2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate (PubChem CID 16514857) has the molecular formula C26H23FN2O4 and a molecular weight of 446.48 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 16514857 |
| Molecular Formula | C26H23FN2O4 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 2-[(3-methylphenyl)methoxy]benzoate |
| SMILES | Cc1cccc(COc2ccccc2C(=O)OCC(=O)N(CCC#N)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H23FN2O4/c1-19-6-4-7-20(16-19)17-32-24-9-3-2-8-23(24)26(31)33-18-25(30)29(15-5-14-28)22-12-10-21(27)11-13-22/h2-4,6-13,16H,5,15,17-18H2,1H3 |
| InChIKey | YTLVOBGQRXLISZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |