C17H16N2O4 — CID 8966058
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-methylfuran-3-carboxylate (PubChem CID 8966058) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-methylfuran-3-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8966058 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] 2-methylfuran-3-carboxylate |
| SMILES | Cc1occc1C(=O)OCC(=O)N(CCC#N)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O4/c1-13-15(8-11-22-13)17(21)23-12-16(20)19(10-5-9-18)14-6-3-2-4-7-14/h2-4,6-8,11H,5,10,12H2,1H3 |
| InChIKey | RQZZHUHUADDFHC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |