C22H18N2O5 — CID 7785476
[2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 2-oxochromene-3-carboxylate (PubChem CID 7785476) has the molecular formula C22H18N2O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 7785476 |
| Molecular Formula | C22H18N2O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-methylanilino]-2-oxoethyl] 2-oxochromene-3-carboxylate |
| SMILES | Cc1ccc(N(CCC#N)C(=O)COC(=O)c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C22H18N2O5/c1-15-7-9-17(10-8-15)24(12-4-11-23)20(25)14-28-21(26)18-13-16-5-2-3-6-19(16)29-22(18)27/h2-3,5-10,13H,4,12,14H2,1H3 |
| InChIKey | SKBWSPDZGQXFKH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 100.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|