C21H17FN2O4 — CID 7995434
[2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 7995434) has the molecular formula C21H17FN2O4 and a molecular weight of 380.38 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7995434 |
| Molecular Formula | C21H17FN2O4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [2-[N-(2-cyanoethyl)-4-fluoroanilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)N(CCC#N)c2ccc(F)cc2)oc2ccccc12 |
| InChI | InChI=1S/C21H17FN2O4/c1-14-17-5-2-3-6-18(17)28-20(14)21(26)27-13-19(25)24(12-4-11-23)16-9-7-15(22)8-10-16/h2-3,5-10H,4,12-13H2,1H3 |
| InChIKey | ZSEIWDZXBYRBCE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |