C21H18FNO4 — CID 8567365
[2-oxo-2-(N-prop-2-enylanilino)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8567365) has the molecular formula C21H18FNO4 and a molecular weight of 367.38 g/mol. Its IUPAC name is [2-oxo-2-(N-prop-2-enylanilino)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-oxo-2-(N-prop-2-enylanilino)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8567365 |
| Molecular Formula | C21H18FNO4 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [2-oxo-2-(N-prop-2-enylanilino)ethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | C=CCN(C(=O)COC(=O)c1oc2ccc(F)cc2c1C)c1ccccc1 |
| InChI | InChI=1S/C21H18FNO4/c1-3-11-23(16-7-5-4-6-8-16)19(24)13-26-21(25)20-14(2)17-12-15(22)9-10-18(17)27-20/h3-10,12H,1,11,13H2,2H3 |
| InChIKey | IMXZDKDYDOUPGZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|