C17H19FN2O5 — CID 8950502
[2-(butylcarbamoylamino)-2-oxoethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8950502) has the molecular formula C17H19FN2O5 and a molecular weight of 350.35 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8950502 |
| Molecular Formula | C17H19FN2O5 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCCCNC(=O)NC(=O)COC(=O)c1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C17H19FN2O5/c1-3-4-7-19-17(23)20-14(21)9-24-16(22)15-10(2)12-8-11(18)5-6-13(12)25-15/h5-6,8H,3-4,7,9H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | PUGBUFNUNRLHFO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|