C18H12Cl2FNO4 — CID 8554370
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8554370) has the molecular formula C18H12Cl2FNO4 and a molecular weight of 396.20 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8554370 |
| Molecular Formula | C18H12Cl2FNO4 |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)Nc2ccc(F)cc2Cl)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H12Cl2FNO4/c1-9-12-6-10(19)2-5-15(12)26-17(9)18(24)25-8-16(23)22-14-4-3-11(21)7-13(14)20/h2-7H,8H2,1H3,(H,22,23) |
| InChIKey | HZDNOUWONPUTNG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |