C18H12Cl3NO4 — CID 16506341
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 16506341) has the molecular formula C18H12Cl3NO4 and a molecular weight of 412.66 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16506341 |
| Molecular Formula | C18H12Cl3NO4 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)oc2ccccc12 |
| InChI | InChI=1S/C18H12Cl3NO4/c1-9-10-4-2-3-5-15(10)26-17(9)18(24)25-8-16(23)22-14-7-12(20)11(19)6-13(14)21/h2-7H,8H2,1H3,(H,22,23) |
| InChIKey | GNFXSQWEZSATEU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|