C22H24N2O4 — CID 16506325
[2-[4-(diethylamino)anilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 16506325) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is [2-[4-(diethylamino)anilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16506325 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCN(CC)c1ccc(NC(=O)COC(=O)c2oc3ccccc3c2C)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-4-24(5-2)17-12-10-16(11-13-17)23-20(25)14-27-22(26)21-15(3)18-8-6-7-9-19(18)28-21/h6-13H,4-5,14H2,1-3H3,(H,23,25) |
| InChIKey | NXGQXIXYYVNJPZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|