C20H18N2O6 — CID 16506360
[2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 16506360) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16506360 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [2-[(4-methoxyphenyl)carbamoylamino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | COc1ccc(NC(=O)NC(=O)COC(=O)c2oc3ccccc3c2C)cc1 |
| InChI | InChI=1S/C20H18N2O6/c1-12-15-5-3-4-6-16(15)28-18(12)19(24)27-11-17(23)22-20(25)21-13-7-9-14(26-2)10-8-13/h3-10H,11H2,1-2H3,(H2,21,22,23,25) |
| InChIKey | SZHPJEFDAPPPLZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |