C20H18N2O5 — CID 7239225
[2-(3-acetamidoanilino)-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 7239225) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is [2-(3-acetamidoanilino)-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-(3-acetamidoanilino)-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7239225 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [2-(3-acetamidoanilino)-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CC(=O)Nc1cccc(NC(=O)COC(=O)c2oc3ccccc3c2C)c1 |
| InChI | InChI=1S/C20H18N2O5/c1-12-16-8-3-4-9-17(16)27-19(12)20(25)26-11-18(24)22-15-7-5-6-14(10-15)21-13(2)23/h3-10H,11H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | JNGSSFUIGAWAGY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |