C13H13ClO3 — CID 112724856
propyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 112724856) has the molecular formula C13H13ClO3 and a molecular weight of 252.70 g/mol. Its IUPAC name is propyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | propyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 112724856 |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | propyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCCOC(=O)c1oc2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C13H13ClO3/c1-3-6-16-13(15)12-8(2)10-7-9(14)4-5-11(10)17-12/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | CFCSIILNOJGRDK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |