C16H16ClNO5 — CID 8554196
(2-morpholin-4-yl-2-oxoethyl) 5-chloro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8554196) has the molecular formula C16H16ClNO5 and a molecular weight of 337.76 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 5-chloro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8554196 |
| Molecular Formula | C16H16ClNO5 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)N2CCOCC2)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H16ClNO5/c1-10-12-8-11(17)2-3-13(12)23-15(10)16(20)22-9-14(19)18-4-6-21-7-5-18/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | BHQKRHNMFZWQAL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |