C17H20N2O6S — CID 27908253
[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 27908253) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 27908253 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)N2CCN(S(C)(=O)=O)CC2)oc2ccccc12 |
| InChI | InChI=1S/C17H20N2O6S/c1-12-13-5-3-4-6-14(13)25-16(12)17(21)24-11-15(20)18-7-9-19(10-8-18)26(2,22)23/h3-6H,7-11H2,1-2H3 |
| InChIKey | IFZRFCDJIPESQG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |