C17H21NO3 — CID 649473
2-piperidin-1-ylethyl 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 649473) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | 2-piperidin-1-ylethyl 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 649473 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-piperidin-1-ylethyl 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCCN2CCCCC2)oc2ccccc12 |
| InChI | InChI=1S/C17H21NO3/c1-13-14-7-3-4-8-15(14)21-16(13)17(19)20-12-11-18-9-5-2-6-10-18/h3-4,7-8H,2,5-6,9-12H2,1H3 |
| InChIKey | OWLIVQIGRFUEDC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |