C18H24INO3 — CID 44655993
(1-ethylpiperidin-1-ium-1-yl)methyl 3-methyl-1-benzofuran-2-carboxylate iodide (PubChem CID 44655993) has the molecular formula C18H24INO3 and a molecular weight of 429.30 g/mol. Its IUPAC name is (1-ethylpiperidin-1-ium-1-yl)methyl 3-methyl-1-benzofuran-2-carboxylate iodide.
| Compound Name | (1-ethylpiperidin-1-ium-1-yl)methyl 3-methyl-1-benzofuran-2-carboxylate iodide |
|---|---|
| PubChem CID | 44655993 |
| Molecular Formula | C18H24INO3 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | (1-ethylpiperidin-1-ium-1-yl)methyl 3-methyl-1-benzofuran-2-carboxylate iodide |
| SMILES | CC[N+]1(COC(=O)c2oc3ccccc3c2C)CCCCC1.[I-] |
| InChI | InChI=1S/C18H24NO3.HI/c1-3-19(11-7-4-8-12-19)13-21-18(20)17-14(2)15-9-5-6-10-16(15)22-17;/h5-6,9-10H,3-4,7-8,11-13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NVJJAQYYJGFAGQ-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|