About (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate
(2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 7239384) has the molecular formula C17H13BrO3
and a molecular weight of 345.19 g/mol. Its IUPAC name is (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate |
| PubChem CID | 7239384 |
| Molecular Formula | C17H13BrO3 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCc2ccccc2Br)oc2ccccc12 |
| InChI | InChI=1S/C17H13BrO3/c1-11-13-7-3-5-9-15(13)21-16(11)17(19)20-10-12-6-2-4-8-14(12)18/h2-9H,10H2,1H3 |
| InChIKey | OVYXBHDIUMQLIL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate?
The IUPAC name of (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate (CID 7239384) is (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate.
What is the SMILES notation for (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate?
The canonical SMILES for (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate is Cc1c(C(=O)OCc2ccccc2Br)oc2ccccc12.
What is the InChIKey of (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate?
The InChIKey is OVYXBHDIUMQLIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrO3/c1-11-13-7-3-5-9-15(13)21-16(11)17(19)20-10-12-6-2-4-8-14(12)18/h2-9H,10H2,1H3.
What are the key properties of (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate?
(2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate has a molecular weight of 345.19 g/mol, XLogP of 4.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)methyl 3-methyl-1-benzofuran-2-carboxylate is sourced from PubChem (CID 7239384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).