C17H22ClNO3 — CID 44657185
2-piperidin-1-ium-1-ylethyl 3-methyl-1-benzofuran-2-carboxylate chloride (PubChem CID 44657185) has the molecular formula C17H22ClNO3 and a molecular weight of 323.82 g/mol. Its IUPAC name is 2-piperidin-1-ium-1-ylethyl 3-methyl-1-benzofuran-2-carboxylate chloride.
| Compound Name | 2-piperidin-1-ium-1-ylethyl 3-methyl-1-benzofuran-2-carboxylate chloride |
|---|---|
| PubChem CID | 44657185 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-piperidin-1-ium-1-ylethyl 3-methyl-1-benzofuran-2-carboxylate chloride |
| SMILES | Cc1c(C(=O)OCC[NH+]2CCCCC2)oc2ccccc12.[Cl-] |
| InChI | InChI=1S/C17H21NO3.ClH/c1-13-14-7-3-4-8-15(14)21-16(13)17(19)20-12-11-18-9-5-2-6-10-18;/h3-4,7-8H,2,5-6,9-12H2,1H3;1H |
| InChIKey | LOVXXQBEUFUKET-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |