About (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate
(3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 175305783) has the molecular formula C16H14O4
and a molecular weight of 270.28 g/mol. Its IUPAC name is (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate.
Molecular Properties
| Compound Name | (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate |
| PubChem CID | 175305783 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OC2=CC(=O)CCC2)oc2ccccc12 |
| InChI | InChI=1S/C16H14O4/c1-10-13-7-2-3-8-14(13)20-15(10)16(18)19-12-6-4-5-11(17)9-12/h2-3,7-9H,4-6H2,1H3 |
| InChIKey | AJHMNPGARJIMPH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate?
The IUPAC name of (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate (CID 175305783) is (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate.
What is the SMILES notation for (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate?
The canonical SMILES for (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate is Cc1c(C(=O)OC2=CC(=O)CCC2)oc2ccccc12.
What is the InChIKey of (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate?
The InChIKey is AJHMNPGARJIMPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4/c1-10-13-7-2-3-8-14(13)20-15(10)16(18)19-12-6-4-5-11(17)9-12/h2-3,7-9H,4-6H2,1H3.
What are the key properties of (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate?
(3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate has a molecular weight of 270.28 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxocyclohexen-1-yl) 3-methyl-1-benzofuran-2-carboxylate is sourced from PubChem (CID 175305783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).