C16H11ClO4S — CID 8554562
(2-oxo-2-thiophen-2-ylethyl) 5-chloro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 8554562) has the molecular formula C16H11ClO4S and a molecular weight of 334.78 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 5-chloro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 8554562 |
| Molecular Formula | C16H11ClO4S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)c2cccs2)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H11ClO4S/c1-9-11-7-10(17)4-5-13(11)21-15(9)16(19)20-8-12(18)14-3-2-6-22-14/h2-7H,8H2,1H3 |
| InChIKey | SKHWGJMOSKXYLW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |