C13H13ClO3S — CID 78831811
2-methylsulfanylethyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 78831811) has the molecular formula C13H13ClO3S and a molecular weight of 284.76 g/mol. Its IUPAC name is 2-methylsulfanylethyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | 2-methylsulfanylethyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 78831811 |
| Molecular Formula | C13H13ClO3S |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-methylsulfanylethyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CSCCOC(=O)c1oc2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C13H13ClO3S/c1-8-10-7-9(14)3-4-11(10)17-12(8)13(15)16-5-6-18-2/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | JHIWFJQCPUXPOB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|