C18H15ClO4 — CID 7186927
(4-chlorophenyl)methyl 5-methoxy-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 7186927) has the molecular formula C18H15ClO4 and a molecular weight of 330.77 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 5-methoxy-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | (4-chlorophenyl)methyl 5-methoxy-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7186927 |
| Molecular Formula | C18H15ClO4 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (4-chlorophenyl)methyl 5-methoxy-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | COc1ccc2oc(C(=O)OCc3ccc(Cl)cc3)c(C)c2c1 |
| InChI | InChI=1S/C18H15ClO4/c1-11-15-9-14(21-2)7-8-16(15)23-17(11)18(20)22-10-12-3-5-13(19)6-4-12/h3-9H,10H2,1-2H3 |
| InChIKey | TYRBERCAZZPRPM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |