C14H15BrO4 — CID 55354978
2-ethoxyethyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 55354978) has the molecular formula C14H15BrO4 and a molecular weight of 327.17 g/mol. Its IUPAC name is 2-ethoxyethyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | 2-ethoxyethyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 55354978 |
| Molecular Formula | C14H15BrO4 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-ethoxyethyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOCCOC(=O)c1oc2ccc(Br)cc2c1C |
| InChI | InChI=1S/C14H15BrO4/c1-3-17-6-7-18-14(16)13-9(2)11-8-10(15)4-5-12(11)19-13/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | FGIDAPSUFPGRSP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|