C14H12BrNO3 — CID 39903155
3-cyanopropyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 39903155) has the molecular formula C14H12BrNO3 and a molecular weight of 322.16 g/mol. Its IUPAC name is 3-cyanopropyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | 3-cyanopropyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 39903155 |
| Molecular Formula | C14H12BrNO3 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 3-cyanopropyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCCCC#N)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C14H12BrNO3/c1-9-11-8-10(15)4-5-12(11)19-13(9)14(17)18-7-3-2-6-16/h4-5,8H,2-3,7H2,1H3 |
| InChIKey | SVUJJYULAMTVEB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|