C14H15BrO3 — CID 78915211
butyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 78915211) has the molecular formula C14H15BrO3 and a molecular weight of 311.18 g/mol. Its IUPAC name is butyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | butyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 78915211 |
| Molecular Formula | C14H15BrO3 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | butyl 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCCCOC(=O)c1oc2ccc(Br)cc2c1C |
| InChI | InChI=1S/C14H15BrO3/c1-3-4-7-17-14(16)13-9(2)11-8-10(15)5-6-12(11)18-13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | IGQYXXUJEYHMCQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|