C18H19BrN2O5 — CID 3914686
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 3914686) has the molecular formula C18H19BrN2O5 and a molecular weight of 423.26 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 3914686 |
| Molecular Formula | C18H19BrN2O5 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)NC(=O)NC2CCCC2)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C18H19BrN2O5/c1-10-13-8-11(19)6-7-14(13)26-16(10)17(23)25-9-15(22)21-18(24)20-12-4-2-3-5-12/h6-8,12H,2-5,9H2,1H3,(H2,20,21,22,24) |
| InChIKey | FMWYALNOJNJVAO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |