C24H24N2O5 — CID 7239213
[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate (PubChem CID 7239213) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7239213 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)Nc2ccccc2C(=O)NC2CCCC2)oc2ccccc12 |
| InChI | InChI=1S/C24H24N2O5/c1-15-17-10-5-7-13-20(17)31-22(15)24(29)30-14-21(27)26-19-12-6-4-11-18(19)23(28)25-16-8-2-3-9-16/h4-7,10-13,16H,2-3,8-9,14H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | DEUPTZCESSSRSZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |