C19H20N2O5 — CID 7813805
[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] furan-2-carboxylate (PubChem CID 7813805) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 7813805 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccco1)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C19H20N2O5/c22-17(12-26-19(24)16-10-5-11-25-16)21-15-9-4-3-8-14(15)18(23)20-13-6-1-2-7-13/h3-5,8-11,13H,1-2,6-7,12H2,(H,20,23)(H,21,22) |
| InChIKey | WNPXHHQMCVMPNA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |