C20H22N4O4 — CID 8634261
[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate (PubChem CID 8634261) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate.
| Compound Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 8634261 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
| SMILES | Cc1cnc(C(=O)OCC(=O)Nc2ccccc2C(=O)NC2CCCC2)cn1 |
| InChI | InChI=1S/C20H22N4O4/c1-13-10-22-17(11-21-13)20(27)28-12-18(25)24-16-9-5-4-8-15(16)19(26)23-14-6-2-3-7-14/h4-5,8-11,14H,2-3,6-7,12H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | GHUGCZIGFQXXHZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |