C13H17N3O3 — CID 4137428
[2-(cyclopentylamino)-2-oxoethyl] 5-methylpyrazine-2-carboxylate (PubChem CID 4137428) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 5-methylpyrazine-2-carboxylate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 4137428 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
| SMILES | Cc1cnc(C(=O)OCC(=O)NC2CCCC2)cn1 |
| InChI | InChI=1S/C13H17N3O3/c1-9-6-15-11(7-14-9)13(18)19-8-12(17)16-10-4-2-3-5-10/h6-7,10H,2-5,8H2,1H3,(H,16,17) |
| InChIKey | GMWHSFISUXDQNH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |