C12H17N3O3 — CID 2693222
[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate (PubChem CID 2693222) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate.
| Compound Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 2693222 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
| SMILES | CC[C@@H](C)NC(=O)COC(=O)c1cnc(C)cn1 |
| InChI | InChI=1S/C12H17N3O3/c1-4-8(2)15-11(16)7-18-12(17)10-6-13-9(3)5-14-10/h5-6,8H,4,7H2,1-3H3,(H,15,16)/t8-/m1/s1 |
| InChIKey | XTKPVBASUKKWAP-MRVPVSSYSA-N |
| XLogP | 0.86 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |