C22H21N3O5 — CID 7950221
[2-[4-(4-ethoxyphenoxy)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate (PubChem CID 7950221) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is [2-[4-(4-ethoxyphenoxy)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate.
| Compound Name | [2-[4-(4-ethoxyphenoxy)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7950221 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [2-[4-(4-ethoxyphenoxy)anilino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
| SMILES | CCOc1ccc(Oc2ccc(NC(=O)COC(=O)c3cnc(C)cn3)cc2)cc1 |
| InChI | InChI=1S/C22H21N3O5/c1-3-28-17-8-10-19(11-9-17)30-18-6-4-16(5-7-18)25-21(26)14-29-22(27)20-13-23-15(2)12-24-20/h4-13H,3,14H2,1-2H3,(H,25,26) |
| InChIKey | VSTZRNFRRCAXCJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |