C20H17N5O3 — CID 7760622
[2-oxo-2-(4-phenyldiazenylanilino)ethyl] 5-methylpyrazine-2-carboxylate (PubChem CID 7760622) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 5-methylpyrazine-2-carboxylate.
| Compound Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7760622 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 5-methylpyrazine-2-carboxylate |
| SMILES | Cc1cnc(C(=O)OCC(=O)Nc2ccc(/N=N/c3ccccc3)cc2)cn1 |
| InChI | InChI=1S/C20H17N5O3/c1-14-11-22-18(12-21-14)20(27)28-13-19(26)23-15-7-9-17(10-8-15)25-24-16-5-3-2-4-6-16/h2-12H,13H2,1H3,(H,23,26)/b25-24+ |
| InChIKey | OBTIJADGNHSLNE-OCOZRVBESA-N |
| XLogP | 4.00 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|