C15H13N3O4 — CID 7950061
(2-benzamido-2-oxoethyl) 5-methylpyrazine-2-carboxylate (PubChem CID 7950061) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 5-methylpyrazine-2-carboxylate.
| Compound Name | (2-benzamido-2-oxoethyl) 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7950061 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 5-methylpyrazine-2-carboxylate |
| SMILES | Cc1cnc(C(=O)OCC(=O)NC(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C15H13N3O4/c1-10-7-17-12(8-16-10)15(21)22-9-13(19)18-14(20)11-5-3-2-4-6-11/h2-8H,9H2,1H3,(H,18,19,20) |
| InChIKey | CJQCQGNZAKYOLZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |