C16H15N3O5 — CID 2630390
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate (PubChem CID 2630390) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 2630390 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-methylpyrazine-2-carboxylate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)c1cnc(C)cn1 |
| InChI | InChI=1S/C16H15N3O5/c1-10-7-18-12(8-17-10)16(22)24-9-14(20)19-15(21)11-5-3-4-6-13(11)23-2/h3-8H,9H2,1-2H3,(H,19,20,21) |
| InChIKey | FMGRBLNIFJTYSF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |