C17H13F2NO5 — CID 2515349
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2,6-difluorobenzoate (PubChem CID 2515349) has the molecular formula C17H13F2NO5 and a molecular weight of 349.29 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2,6-difluorobenzoate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 2515349 |
| Molecular Formula | C17H13F2NO5 |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2,6-difluorobenzoate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C17H13F2NO5/c1-24-13-8-3-2-5-10(13)16(22)20-14(21)9-25-17(23)15-11(18)6-4-7-12(15)19/h2-8H,9H2,1H3,(H,20,21,22) |
| InChIKey | RRGVGQQEMDRONY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |