C16H15NO6 — CID 2635522
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-methylfuran-2-carboxylate (PubChem CID 2635522) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-methylfuran-2-carboxylate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 2635522 |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 5-methylfuran-2-carboxylate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)c1ccc(C)o1 |
| InChI | InChI=1S/C16H15NO6/c1-10-7-8-13(23-10)16(20)22-9-14(18)17-15(19)11-5-3-4-6-12(11)21-2/h3-8H,9H2,1-2H3,(H,17,18,19) |
| InChIKey | DIEHLBDYGRLIQW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |