C16H14N2O5 — CID 7776378
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] pyridine-2-carboxylate (PubChem CID 7776378) has the molecular formula C16H14N2O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] pyridine-2-carboxylate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 7776378 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] pyridine-2-carboxylate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)c1ccccn1 |
| InChI | InChI=1S/C16H14N2O5/c1-22-13-8-3-2-6-11(13)15(20)18-14(19)10-23-16(21)12-7-4-5-9-17-12/h2-9H,10H2,1H3,(H,18,19,20) |
| InChIKey | XECXFNCCKQJIEL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |