C20H21NO7 — CID 39415072
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(2-ethoxyphenoxy)acetate (PubChem CID 39415072) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(2-ethoxyphenoxy)acetate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(2-ethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 39415072 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 2-(2-ethoxyphenoxy)acetate |
| SMILES | CCOc1ccccc1OCC(=O)OCC(=O)NC(=O)c1ccccc1OC |
| InChI | InChI=1S/C20H21NO7/c1-3-26-16-10-6-7-11-17(16)27-13-19(23)28-12-18(22)21-20(24)14-8-4-5-9-15(14)25-2/h4-11H,3,12-13H2,1-2H3,(H,21,22,24) |
| InChIKey | OKKWKZVTWQTEMZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |